Difference between revisions of "Amino-Acids-20"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17046 == * common-name: ** 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine * molecular-weight: ** 842.848 * inchi-...")
(Created page with "Category:metabolite == Metabolite SINAPYL-ALCOHOL == * common-name: ** sinapyl alcohol * molecular-weight: ** 210.229 * inchi-key: ** lzfopexouvtgjs-onegzznksa-n * smiles:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17046 ==
+
== Metabolite SINAPYL-ALCOHOL ==
 
* common-name:
 
* common-name:
** 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine
+
** sinapyl alcohol
 
* molecular-weight:
 
* molecular-weight:
** 842.848
+
** 210.229
 
* inchi-key:
 
* inchi-key:
** yjisldwviydioe-wgtgpsahsa-l
+
** lzfopexouvtgjs-onegzznksa-n
 
* smiles:
 
* smiles:
** c(sc2(cc1(=cc=cc=c1))(nc(=o)c(scc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o)(co)nc(=o)2))c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
+
** coc1(c=c(c=cco)c=c(oc)c(o)=1)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15680]]
+
* [[RXN-1125]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine}}
+
{{#set: common-name=sinapyl alcohol}}
{{#set: molecular-weight=842.848}}
+
{{#set: molecular-weight=210.229}}
{{#set: inchi-key=inchikey=yjisldwviydioe-wgtgpsahsa-l}}
+
{{#set: inchi-key=inchikey=lzfopexouvtgjs-onegzznksa-n}}

Revision as of 18:58, 17 March 2021

Metabolite SINAPYL-ALCOHOL

  • common-name:
    • sinapyl alcohol
  • molecular-weight:
    • 210.229
  • inchi-key:
    • lzfopexouvtgjs-onegzznksa-n
  • smiles:
    • coc1(c=c(c=cco)c=c(oc)c(o)=1)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality