Difference between revisions of "Amino-Acids-20"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DETHIOBIOTIN == * common-name: ** dethiobiotin * molecular-weight: ** 213.256 * inchi-key: ** autolbmxddtrrt-uhfffaoysa-m * smiles: ** cc...")
(Created page with "Category:metabolite == Metabolite Amino-Acids-20 == * common-name: ** a proteinogenic amino acid == Reaction(s) known to consume the compound == * L-AMINO-ACID-OXIDASE-R...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DETHIOBIOTIN ==
+
== Metabolite Amino-Acids-20 ==
 
* common-name:
 
* common-name:
** dethiobiotin
+
** a proteinogenic amino acid
* molecular-weight:
 
** 213.256
 
* inchi-key:
 
** autolbmxddtrrt-uhfffaoysa-m
 
* smiles:
 
** cc1(nc(=o)nc1cccccc(=o)[o-])
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.8.1.6-RXN]]
+
* [[L-AMINO-ACID-OXIDASE-RXN]]
* [[RXN-17472]]
+
* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
 +
* [[RXN-6601]]
 +
* [[RXN66-336]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DETHIOBIOTIN-SYN-RXN]]
+
* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dethiobiotin}}
+
{{#set: common-name=a proteinogenic amino acid}}
{{#set: molecular-weight=213.256}}
 
{{#set: inchi-key=inchikey=autolbmxddtrrt-uhfffaoysa-m}}
 

Latest revision as of 19:32, 17 March 2021

Metabolite Amino-Acids-20

  • common-name:
    • a proteinogenic amino acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality