Difference between revisions of "Aromatic-Oxoacids"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11523 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyhexanoyl)-coa * molecular-weight: ** 1027.866 * inchi-...")
 
(Created page with "Category:metabolite == Metabolite Aromatic-Oxoacids == * common-name: ** an aromatic 2-oxo-acid == Reaction(s) known to consume the compound == * 2.6.1.57-RXN == React...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11523 ==
+
== Metabolite Aromatic-Oxoacids ==
 
* common-name:
 
* common-name:
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyhexanoyl)-coa
+
** an aromatic 2-oxo-acid
* molecular-weight:
 
** 1027.866
 
* inchi-key:
 
** omdqviuydjawhx-qhzcmhftsa-j
 
* smiles:
 
** ccc=ccc1(c(ccc(=o)1)cccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10702]]
+
* [[2.6.1.57-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10704]]
+
* [[2.6.1.57-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyhexanoyl)-coa}}
+
{{#set: common-name=an aromatic 2-oxo-acid}}
{{#set: molecular-weight=1027.866}}
 
{{#set: inchi-key=inchikey=omdqviuydjawhx-qhzcmhftsa-j}}
 

Latest revision as of 19:34, 17 March 2021

Metabolite Aromatic-Oxoacids

  • common-name:
    • an aromatic 2-oxo-acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality