Difference between revisions of "B-ALANINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite D-RIBULOSE-15-P2 == * common-name: ** d-ribulose-1,5-bisphosphate * molecular-weight: ** 306.059 * inchi-key: ** yahzabjorduqgo-nqxxgfsbs...")
(Created page with "Category:metabolite == Metabolite B-ALANINE == * common-name: ** β-alanine * molecular-weight: ** 89.094 * inchi-key: ** ucmirnveixfbks-uhfffaoysa-n * smiles: ** c(c[...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite D-RIBULOSE-15-P2 ==
+
== Metabolite B-ALANINE ==
 
* common-name:
 
* common-name:
** d-ribulose-1,5-bisphosphate
+
** β-alanine
 
* molecular-weight:
 
* molecular-weight:
** 306.059
+
** 89.094
 
* inchi-key:
 
* inchi-key:
** yahzabjorduqgo-nqxxgfsbsa-j
+
** ucmirnveixfbks-uhfffaoysa-n
 
* smiles:
 
* smiles:
** c(op([o-])([o-])=o)c(o)c(o)c(=o)cop(=o)([o-])[o-]
+
** c(c[n+])c([o-])=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PHOSPHORIBULOKINASE-RXN]]
+
* [[PANTOATE-BETA-ALANINE-LIG-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PHOSPHORIBULOKINASE-RXN]]
+
* [[BETA-UREIDOPROPIONASE-RXN]]
 +
* [[RXN-6382]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-ribulose-1,5-bisphosphate}}
+
{{#set: common-name=β-alanine}}
{{#set: molecular-weight=306.059}}
+
{{#set: molecular-weight=89.094}}
{{#set: inchi-key=inchikey=yahzabjorduqgo-nqxxgfsbsa-j}}
+
{{#set: inchi-key=inchikey=ucmirnveixfbks-uhfffaoysa-n}}

Latest revision as of 19:33, 17 March 2021

Metabolite B-ALANINE

  • common-name:
    • β-alanine
  • molecular-weight:
    • 89.094
  • inchi-key:
    • ucmirnveixfbks-uhfffaoysa-n
  • smiles:
    • c(c[n+])c([o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality