Difference between revisions of "B-ALANINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite MANNITOL-1P == * common-name: ** d-mannitol 1-phosphate * molecular-weight: ** 260.137 * inchi-key: ** gactwzzmvmukng-kvtdhhqdsa-l * smil...")
(Created page with "Category:metabolite == Metabolite B-ALANINE == * common-name: ** β-alanine * molecular-weight: ** 89.094 * inchi-key: ** ucmirnveixfbks-uhfffaoysa-n * smiles: ** c(c[...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite MANNITOL-1P ==
+
== Metabolite B-ALANINE ==
 
* common-name:
 
* common-name:
** d-mannitol 1-phosphate
+
** β-alanine
 
* molecular-weight:
 
* molecular-weight:
** 260.137
+
** 89.094
 
* inchi-key:
 
* inchi-key:
** gactwzzmvmukng-kvtdhhqdsa-l
+
** ucmirnveixfbks-uhfffaoysa-n
 
* smiles:
 
* smiles:
** c(c(c(c(c(cop([o-])([o-])=o)o)o)o)o)o
+
** c(c[n+])c([o-])=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[MANNITOL-1-PHOSPHATASE-RXN]]
+
* [[PANTOATE-BETA-ALANINE-LIG-RXN]]
* [[MANNPDEHYDROG-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[MANNPDEHYDROG-RXN]]
+
* [[BETA-UREIDOPROPIONASE-RXN]]
 +
* [[RXN-6382]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-mannitol 1-phosphate}}
+
{{#set: common-name=β-alanine}}
{{#set: molecular-weight=260.137}}
+
{{#set: molecular-weight=89.094}}
{{#set: inchi-key=inchikey=gactwzzmvmukng-kvtdhhqdsa-l}}
+
{{#set: inchi-key=inchikey=ucmirnveixfbks-uhfffaoysa-n}}

Latest revision as of 19:33, 17 March 2021

Metabolite B-ALANINE

  • common-name:
    • β-alanine
  • molecular-weight:
    • 89.094
  • inchi-key:
    • ucmirnveixfbks-uhfffaoysa-n
  • smiles:
    • c(c[n+])c([o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality