Difference between revisions of "B-Hydroxy-cis-D5-dodecenoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11518 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(e-octa-2-enoyl)-coa * molecular-weight: ** 1037.905 * inchi-key:...")
 
(Created page with "Category:metabolite == Metabolite GALACTOSE == * common-name: ** β-d-galactopyranose * molecular-weight: ** 180.157 * inchi-key: ** wqzgkkkjijffok-fprjbgldsa-n * smil...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-11518 ==
+
== Metabolite GALACTOSE ==
 
* common-name:
 
* common-name:
−
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(e-octa-2-enoyl)-coa
+
** β-d-galactopyranose
 
* molecular-weight:
 
* molecular-weight:
−
** 1037.905
+
** 180.157
 
* inchi-key:
 
* inchi-key:
−
** wdbpmrzybzciqe-dzxubonnsa-j
+
** wqzgkkkjijffok-fprjbgldsa-n
 
* smiles:
 
* smiles:
−
** ccc=ccc1(c(ccc(=o)1)cccccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
+
** c(o)c1(oc(o)c(o)c(o)c(o)1)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-10697]]
+
* [[ALDOSE1EPIM-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-10696]]
+
* [[ALDOSE1EPIM-RXN]]
 +
* [[BETAGALACTOSID-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(e-octa-2-enoyl)-coa}}
+
{{#set: common-name=β-d-galactopyranose}}
−
{{#set: molecular-weight=1037.905}}
+
{{#set: molecular-weight=180.157}}
−
{{#set: inchi-key=inchikey=wdbpmrzybzciqe-dzxubonnsa-j}}
+
{{#set: inchi-key=inchikey=wqzgkkkjijffok-fprjbgldsa-n}}

Revision as of 17:53, 13 January 2021

Metabolite GALACTOSE

  • common-name:
    • β-d-galactopyranose
  • molecular-weight:
    • 180.157
  • inchi-key:
    • wqzgkkkjijffok-fprjbgldsa-n
  • smiles:
    • c(o)c1(oc(o)c(o)c(o)c(o)1)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=B-Hydroxy-cis-D5-dodecenoyl-ACPs&oldid=17608"