Difference between revisions of "CPD-12443"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite P-HYDROXY-PHENYLPYRUVATE == * common-name: ** 3-(4-hydroxyphenyl)pyruvate * molecular-weight: ** 179.152 * inchi-key: ** kkadpxvioxhvkn-u...")
(Created page with "Category:metabolite == Metabolite CPD1F-129 == * common-name: ** β-carotene * molecular-weight: ** 536.882 * inchi-key: ** oenhqhleoonyie-jltxgrslsa-n * smiles: ** cc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite P-HYDROXY-PHENYLPYRUVATE ==
+
== Metabolite CPD1F-129 ==
 
* common-name:
 
* common-name:
** 3-(4-hydroxyphenyl)pyruvate
+
** β-carotene
 
* molecular-weight:
 
* molecular-weight:
** 179.152
+
** 536.882
 
* inchi-key:
 
* inchi-key:
** kkadpxvioxhvkn-uhfffaoysa-m
+
** oenhqhleoonyie-jltxgrslsa-n
 
* smiles:
 
* smiles:
** c1(c(cc(c([o-])=o)=o)=cc=c(c=1)o)
+
** cc(c=cc=c(c=cc1(c(c)(c)cccc=1c))c)=cc=cc=c(c=cc=c(c=cc2(=c(cccc(c)(c)2)c))c)c
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[4-HYDROXYPHENYLPYRUVATE-DIOXYGENASE-RXN]]
 
* [[RXN3O-4157]]
 
* [[TYROSINE-AMINOTRANSFERASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PREPHENATE-DEHYDROGENASE-NADP+-RXN]]
+
* [[RXN1F-151]]
* [[PREPHENATEDEHYDROG-RXN]]
 
* [[RXN3O-4157]]
 
* [[TYROSINE-AMINOTRANSFERASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-(4-hydroxyphenyl)pyruvate}}
+
{{#set: common-name=β-carotene}}
{{#set: molecular-weight=179.152}}
+
{{#set: molecular-weight=536.882}}
{{#set: inchi-key=inchikey=kkadpxvioxhvkn-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=oenhqhleoonyie-jltxgrslsa-n}}

Revision as of 19:03, 17 March 2021

Metabolite CPD1F-129

  • common-name:
    • β-carotene
  • molecular-weight:
    • 536.882
  • inchi-key:
    • oenhqhleoonyie-jltxgrslsa-n
  • smiles:
    • cc(c=cc=c(c=cc1(c(c)(c)cccc=1c))c)=cc=cc=c(c=cc=c(c=cc2(=c(cccc(c)(c)2)c))c)c

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality