Difference between revisions of "CPD-12443"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite P-HYDROXY-PHENYLPYRUVATE == * common-name: ** 3-(4-hydroxyphenyl)pyruvate * molecular-weight: ** 179.152 * inchi-key: ** kkadpxvioxhvkn-u...") |
(Created page with "Category:metabolite == Metabolite CPD1F-129 == * common-name: ** β-carotene * molecular-weight: ** 536.882 * inchi-key: ** oenhqhleoonyie-jltxgrslsa-n * smiles: ** cc...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD1F-129 == |
* common-name: | * common-name: | ||
− | ** | + | ** β-carotene |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 536.882 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** oenhqhleoonyie-jltxgrslsa-n |
* smiles: | * smiles: | ||
− | ** | + | ** cc(c=cc=c(c=cc1(c(c)(c)cccc=1c))c)=cc=cc=c(c=cc=c(c=cc2(=c(cccc(c)(c)2)c))c)c |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN1F-151]] |
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=β-carotene}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=536.882}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=oenhqhleoonyie-jltxgrslsa-n}} |
Revision as of 19:03, 17 March 2021
Contents
Metabolite CPD1F-129
- common-name:
- β-carotene
- molecular-weight:
- 536.882
- inchi-key:
- oenhqhleoonyie-jltxgrslsa-n
- smiles:
- cc(c=cc=c(c=cc1(c(c)(c)cccc=1c))c)=cc=cc=c(c=cc=c(c=cc2(=c(cccc(c)(c)2)c))c)c