Difference between revisions of "CPD-12443"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite P-HYDROXY-PHENYLPYRUVATE == * common-name: ** 3-(4-hydroxyphenyl)pyruvate * molecular-weight: ** 179.152 * inchi-key: ** kkadpxvioxhvkn-u...")
(Created page with "Category:metabolite == Metabolite CPD-12443 == * common-name: ** perillate == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound ==...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite P-HYDROXY-PHENYLPYRUVATE ==
+
== Metabolite CPD-12443 ==
 
* common-name:
 
* common-name:
** 3-(4-hydroxyphenyl)pyruvate
+
** perillate
* molecular-weight:
 
** 179.152
 
* inchi-key:
 
** kkadpxvioxhvkn-uhfffaoysa-m
 
* smiles:
 
** c1(c(cc(c([o-])=o)=o)=cc=c(c=1)o)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[4-HYDROXYPHENYLPYRUVATE-DIOXYGENASE-RXN]]
 
* [[RXN3O-4157]]
 
* [[TYROSINE-AMINOTRANSFERASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PREPHENATE-DEHYDROGENASE-NADP+-RXN]]
+
* [[RXN-14280]]
* [[PREPHENATEDEHYDROG-RXN]]
 
* [[RXN3O-4157]]
 
* [[TYROSINE-AMINOTRANSFERASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-(4-hydroxyphenyl)pyruvate}}
+
{{#set: common-name=perillate}}
{{#set: molecular-weight=179.152}}
 
{{#set: inchi-key=inchikey=kkadpxvioxhvkn-uhfffaoysa-m}}
 

Latest revision as of 19:36, 17 March 2021

Metabolite CPD-12443

  • common-name:
    • perillate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality