Difference between revisions of "CPD-14425"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19148 == * common-name: ** (5z)-dodecenoyl-coa * molecular-weight: ** 943.792 * inchi-key: ** rcvjzgbrlgutkt-cggpsvllsa-j * smiles: *...")
(Created page with "Category:metabolite == Metabolite CPD-14425 == * common-name: ** (2e,7z,10z,13z,16z,19z)-docosahexaenoyl-coa * molecular-weight: ** 1073.981 * inchi-key: ** hgvxutaezaltig...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19148 ==
+
== Metabolite CPD-14425 ==
 
* common-name:
 
* common-name:
** (5z)-dodecenoyl-coa
+
** (2e,7z,10z,13z,16z,19z)-docosahexaenoyl-coa
 
* molecular-weight:
 
* molecular-weight:
** 943.792
+
** 1073.981
 
* inchi-key:
 
* inchi-key:
** rcvjzgbrlgutkt-cggpsvllsa-j
+
** hgvxutaezaltig-hkhrklhhsa-j
 
* smiles:
 
* smiles:
** ccccccc=ccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** ccc=ccc=ccc=ccc=ccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-13445]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17795]]
+
* [[RXN-13444]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(5z)-dodecenoyl-coa}}
+
{{#set: common-name=(2e,7z,10z,13z,16z,19z)-docosahexaenoyl-coa}}
{{#set: molecular-weight=943.792}}
+
{{#set: molecular-weight=1073.981}}
{{#set: inchi-key=inchikey=rcvjzgbrlgutkt-cggpsvllsa-j}}
+
{{#set: inchi-key=inchikey=hgvxutaezaltig-hkhrklhhsa-j}}

Latest revision as of 19:35, 17 March 2021

Metabolite CPD-14425

  • common-name:
    • (2e,7z,10z,13z,16z,19z)-docosahexaenoyl-coa
  • molecular-weight:
    • 1073.981
  • inchi-key:
    • hgvxutaezaltig-hkhrklhhsa-j
  • smiles:
    • ccc=ccc=ccc=ccc=ccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality