Difference between revisions of "CPD-24184"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15172 == * common-name: ** 6,7-dehydrobaicalein * molecular-weight: ** 268.225 * inchi-key: ** lsqwciyrgvwpfx-uhfffaoysa-n * smiles:...")
(Created page with "Category:metabolite == Metabolite CPD-24184 == == Reaction(s) known to consume the compound == * RXN-22206 == Reaction(s) known to produce the compound == == Reaction(...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15172 ==
+
== Metabolite CPD-24184 ==
* common-name:
 
** 6,7-dehydrobaicalein
 
* molecular-weight:
 
** 268.225
 
* inchi-key:
 
** lsqwciyrgvwpfx-uhfffaoysa-n
 
* smiles:
 
** c1(c=cc(=cc=1)c2(=cc(=o)c3(c(o2)=cc(=o)c(=o)c(o)=3)))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-22206]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14240]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6,7-dehydrobaicalein}}
 
{{#set: molecular-weight=268.225}}
 
{{#set: inchi-key=inchikey=lsqwciyrgvwpfx-uhfffaoysa-n}}
 

Latest revision as of 19:34, 17 March 2021

Metabolite CPD-24184

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality