Difference between revisions of "CPD-24185"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ITP == * common-name: ** itp * molecular-weight: ** 504.137 * inchi-key: ** haejpqiatwhalx-kqynxxcusa-j * smiles: ** c(op(=o)([o-])op([o-...")
 
(Created page with "Category:metabolite == Metabolite CPD-24185 == == Reaction(s) known to consume the compound == * RXN-22198 == Reaction(s) known to produce the compound == * RXN-2220...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ITP ==
+
== Metabolite CPD-24185 ==
* common-name:
 
** itp
 
* molecular-weight:
 
** 504.137
 
* inchi-key:
 
** haejpqiatwhalx-kqynxxcusa-j
 
* smiles:
 
** c(op(=o)([o-])op([o-])(=o)op([o-])([o-])=o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14120]]
+
* [[RXN-22198]]
* [[RXN0-5073]]
 
* [[RXN0-6382]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14120]]
+
* [[RXN-22206]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=itp}}
 
{{#set: molecular-weight=504.137}}
 
{{#set: inchi-key=inchikey=haejpqiatwhalx-kqynxxcusa-j}}
 

Latest revision as of 19:33, 17 March 2021

Metabolite CPD-24185

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality