Difference between revisions of "CPD-3617"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PYRIDOXAMINE == * common-name: ** pyridoxamine * molecular-weight: ** 169.203 * inchi-key: ** nhzmqxzhnvqtqa-uhfffaoysa-o * smiles: ** cc...")
(Created page with "Category:metabolite == Metabolite CPD-3617 == * common-name: ** decanoate * molecular-weight: ** 171.259 * inchi-key: ** ghvnfzfcnzkvnt-uhfffaoysa-m * smiles: ** ccccccccc...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PYRIDOXAMINE ==
+
== Metabolite CPD-3617 ==
 
* common-name:
 
* common-name:
** pyridoxamine
+
** decanoate
 
* molecular-weight:
 
* molecular-weight:
** 169.203
+
** 171.259
 
* inchi-key:
 
* inchi-key:
** nhzmqxzhnvqtqa-uhfffaoysa-o
+
** ghvnfzfcnzkvnt-uhfffaoysa-m
 
* smiles:
 
* smiles:
** cc1(=nc=c(co)c(c[n+])=c(o)1)
+
** cccccccccc(=o)[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PYRAMKIN-RXN]]
+
* [[RXN-13614]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-16653]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pyridoxamine}}
+
{{#set: common-name=decanoate}}
{{#set: molecular-weight=169.203}}
+
{{#set: molecular-weight=171.259}}
{{#set: inchi-key=inchikey=nhzmqxzhnvqtqa-uhfffaoysa-o}}
+
{{#set: inchi-key=inchikey=ghvnfzfcnzkvnt-uhfffaoysa-m}}

Latest revision as of 19:36, 17 March 2021

Metabolite CPD-3617

  • common-name:
    • decanoate
  • molecular-weight:
    • 171.259
  • inchi-key:
    • ghvnfzfcnzkvnt-uhfffaoysa-m
  • smiles:
    • cccccccccc(=o)[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality