Difference between revisions of "CPD-4702"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13912 == * common-name: ** 2-carboxy-l-threo-pentonate * molecular-weight: ** 208.124 * inchi-key: ** cqirjdzgdxtxkf-uhfffaoysa-l * s...")
(Created page with "Category:metabolite == Metabolite CPD-4702 == * common-name: ** 4α-carboxy-5α-cholesta-8,24-dien-3β-ol * inchi-key: ** jhiwifrqjxlneu-gsqagghasa-m * molec...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13912 ==
+
== Metabolite CPD-4702 ==
 
* common-name:
 
* common-name:
** 2-carboxy-l-threo-pentonate
+
** 4α-carboxy-5α-cholesta-8,24-dien-3β-ol
 +
* inchi-key:
 +
** jhiwifrqjxlneu-gsqagghasa-m
 
* molecular-weight:
 
* molecular-weight:
** 208.124
+
** 427.646
* inchi-key:
 
** cqirjdzgdxtxkf-uhfffaoysa-l
 
 
* smiles:
 
* smiles:
** c(c(c(o)c(c([o-])=o)(c([o-])=o)o)o)o
+
** cc(c)=ccc[c@@h](c)[c@h]2(cc[c@h]3(c4(\cc[c@h]1([c@h](c([o-])=o)[c@@h](o)cc[c@@](c)1c(\cc[c@](c)23)=4))))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN66-318]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12871]]
+
* [[RXN-13709]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-carboxy-l-threo-pentonate}}
+
{{#set: common-name=4α-carboxy-5α-cholesta-8,24-dien-3β-ol}}
{{#set: molecular-weight=208.124}}
+
{{#set: inchi-key=inchikey=jhiwifrqjxlneu-gsqagghasa-m}}
{{#set: inchi-key=inchikey=cqirjdzgdxtxkf-uhfffaoysa-l}}
+
{{#set: molecular-weight=427.646}}

Latest revision as of 19:37, 17 March 2021

Metabolite CPD-4702

  • common-name:
    • 4α-carboxy-5α-cholesta-8,24-dien-3β-ol
  • inchi-key:
    • jhiwifrqjxlneu-gsqagghasa-m
  • molecular-weight:
    • 427.646
  • smiles:
    • cc(c)=ccc[c@@h](c)[c@h]2(cc[c@h]3(c4(\cc[c@h]1([c@h](c([o-])=o)[c@@h](o)cc[c@@](c)1c(\cc[c@](c)23)=4))))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality