Difference between revisions of "CPD-504"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite OCTAPRENYL-DIPHOSPHATE == * common-name: ** all-trans-octaprenyl diphosphate * molecular-weight: ** 719.897 * inchi-key: ** ikkldissulffq...")
(Created page with "Category:metabolite == Metabolite PHTYOSPHINGOSINE-1-P == * common-name: ** phytosphingosine 1-phosphate * molecular-weight: ** 396.483 * inchi-key: ** aygoskultisfcw-kszl...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite OCTAPRENYL-DIPHOSPHATE ==
+
== Metabolite PHTYOSPHINGOSINE-1-P ==
 
* common-name:
 
* common-name:
** all-trans-octaprenyl diphosphate
+
** phytosphingosine 1-phosphate
 
* molecular-weight:
 
* molecular-weight:
** 719.897
+
** 396.483
 
* inchi-key:
 
* inchi-key:
** ikkldissulffqo-djmiluhssa-k
+
** aygoskultisfcw-kszliroesa-m
 
* smiles:
 
* smiles:
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
+
** ccccccccccccccc(o)c(c(cop([o-])(=o)[o-])[n+])o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[4OHBENZOATE-OCTAPRENYLTRANSFER-RXN]]
+
* [[RXN-13729]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=all-trans-octaprenyl diphosphate}}
+
{{#set: common-name=phytosphingosine 1-phosphate}}
{{#set: molecular-weight=719.897}}
+
{{#set: molecular-weight=396.483}}
{{#set: inchi-key=inchikey=ikkldissulffqo-djmiluhssa-k}}
+
{{#set: inchi-key=inchikey=aygoskultisfcw-kszliroesa-m}}

Revision as of 18:59, 17 March 2021

Metabolite PHTYOSPHINGOSINE-1-P

  • common-name:
    • phytosphingosine 1-phosphate
  • molecular-weight:
    • 396.483
  • inchi-key:
    • aygoskultisfcw-kszliroesa-m
  • smiles:
    • ccccccccccccccc(o)c(c(cop([o-])(=o)[o-])[n+])o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality