Difference between revisions of "CPD0-2123"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10283 == * common_name: ** 3-oxo-behenoyl-coa * smiles: ** cccccccccccccccccccc(=o)cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-...")
 
(Created page with "Category:metabolite == Metabolite CPD-19158 == * common-name: ** 3-oxo-(9z)-hexadecenoyl-coa * molecular-weight: ** 1013.883 * inchi-key: ** jdnargywmlyada-mdmkaecgsa-j *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-10283 ==
+
== Metabolite CPD-19158 ==
* common_name:
+
* common-name:
** 3-oxo-behenoyl-coa
+
** 3-oxo-(9z)-hexadecenoyl-coa
 +
* molecular-weight:
 +
** 1013.883
 +
* inchi-key:
 +
** jdnargywmlyada-mdmkaecgsa-j
 
* smiles:
 
* smiles:
** cccccccccccccccccccc(=o)cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
+
** ccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
* inchi_key:
 
** inchikey=rkcogguhkptoqj-gnsuaqhmsa-j
 
* molecular_weight:
 
** 1100.059   
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13299]]
+
* [[RXN-17791]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13295]]
+
* [[RXN-17790]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common_name=3-oxo-behenoyl-coa}}
+
{{#set: common-name=3-oxo-(9z)-hexadecenoyl-coa}}
{{#set: inchi_key=inchikey=rkcogguhkptoqj-gnsuaqhmsa-j}}
+
{{#set: molecular-weight=1013.883}}
{{#set: molecular_weight=1100.059    }}
+
{{#set: inchi-key=inchikey=jdnargywmlyada-mdmkaecgsa-j}}

Revision as of 17:54, 13 January 2021

Metabolite CPD-19158

  • common-name:
    • 3-oxo-(9z)-hexadecenoyl-coa
  • molecular-weight:
    • 1013.883
  • inchi-key:
    • jdnargywmlyada-mdmkaecgsa-j
  • smiles:
    • ccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality