Difference between revisions of "CPD0-2123"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10283 == * common_name: ** 3-oxo-behenoyl-coa * smiles: ** cccccccccccccccccccc(=o)cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-...") |
(Created page with "Category:metabolite == Metabolite CPD-19158 == * common-name: ** 3-oxo-(9z)-hexadecenoyl-coa * molecular-weight: ** 1013.883 * inchi-key: ** jdnargywmlyada-mdmkaecgsa-j *...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-19158 == |
− | * | + | * common-name: |
− | ** 3-oxo- | + | ** 3-oxo-(9z)-hexadecenoyl-coa |
+ | * molecular-weight: | ||
+ | ** 1013.883 | ||
+ | * inchi-key: | ||
+ | ** jdnargywmlyada-mdmkaecgsa-j | ||
* smiles: | * smiles: | ||
− | ** | + | ** ccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-17791]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-17790]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: | + | {{#set: common-name=3-oxo-(9z)-hexadecenoyl-coa}} |
− | {{#set: | + | {{#set: molecular-weight=1013.883}} |
− | {{#set: | + | {{#set: inchi-key=inchikey=jdnargywmlyada-mdmkaecgsa-j}} |
Revision as of 17:54, 13 January 2021
Contents
Metabolite CPD-19158
- common-name:
- 3-oxo-(9z)-hexadecenoyl-coa
- molecular-weight:
- 1013.883
- inchi-key:
- jdnargywmlyada-mdmkaecgsa-j
- smiles:
- ccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]