Difference between revisions of "Curation"
Jump to navigation
Jump to search
(Created page with "{{#ask: Category:reaction reconstruction category::manual | ?common-name | ?ec-number | ?reconstruction tool | ?reconstruction source | ?reconstruction comment | ?nb g...") |
(Created page with "Category:metabolite == Metabolite CPD-11407 == * common-name: ** thyroxine sulfate * molecular-weight: ** 855.924 * inchi-key: ** qyxijuzwssqict-lbprgkrzsa-m * smiles: **...") |
||
| Line 1: | Line 1: | ||
| − | + | [[Category:metabolite]] | |
| − | + | == Metabolite CPD-11407 == | |
| − | + | * common-name: | |
| − | + | ** thyroxine sulfate | |
| − | + | * molecular-weight: | |
| − | + | ** 855.924 | |
| − | + | * inchi-key: | |
| − | + | ** qyxijuzwssqict-lbprgkrzsa-m | |
| − | }} | + | * smiles: |
| + | ** c2(c(i)=c(oc1(c=c(c(os(=o)(=o)[o-])=c(c=1)i)i))c(=cc=2cc(c(=o)[o-])[n+])i) | ||
| + | == Reaction(s) known to consume the compound == | ||
| + | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-10614]] | ||
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=thyroxine sulfate}} | ||
| + | {{#set: molecular-weight=855.924}} | ||
| + | {{#set: inchi-key=inchikey=qyxijuzwssqict-lbprgkrzsa-m}} | ||
Revision as of 17:58, 13 January 2021
Contents
Metabolite CPD-11407
- common-name:
- thyroxine sulfate
- molecular-weight:
- 855.924
- inchi-key:
- qyxijuzwssqict-lbprgkrzsa-m
- smiles:
- c2(c(i)=c(oc1(c=c(c(os(=o)(=o)[o-])=c(c=1)i)i))c(=cc=2cc(c(=o)[o-])[n+])i)
