Difference between revisions of "Curation"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11407 == * common-name: ** thyroxine sulfate * molecular-weight: ** 855.924 * inchi-key: ** qyxijuzwssqict-lbprgkrzsa-m * smiles: **...")
(Created page with "Category:metabolite == Metabolite FUM == * common-name: ** fumarate * molecular-weight: ** 114.057 * inchi-key: ** vzcyooqtpochfl-owojbtedsa-l * smiles: ** c(c([o-])=o)=cc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11407 ==
+
== Metabolite FUM ==
 
* common-name:
 
* common-name:
** thyroxine sulfate
+
** fumarate
 
* molecular-weight:
 
* molecular-weight:
** 855.924
+
** 114.057
 
* inchi-key:
 
* inchi-key:
** qyxijuzwssqict-lbprgkrzsa-m
+
** vzcyooqtpochfl-owojbtedsa-l
 
* smiles:
 
* smiles:
** c2(c(i)=c(oc1(c=c(c(os(=o)(=o)[o-])=c(c=1)i)i))c(=cc=2cc(c(=o)[o-])[n+])i)
+
** c(c([o-])=o)=cc(=o)[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[AICARSYN-RXN]]
 +
* [[AMPSYN-RXN]]
 +
* [[ARGSUCCINLYA-RXN]]
 +
* [[FUMARATE-REDUCTASE-NADH-RXN]]
 +
* [[FUMHYDR-RXN]]
 +
* [[RXN0-5245]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10614]]
+
* [[AICARSYN-RXN]]
 +
* [[AMPSYN-RXN]]
 +
* [[ARGSUCCINLYA-RXN]]
 +
* [[FUMARATE-REDUCTASE-NADH-RXN]]
 +
* [[FUMHYDR-RXN]]
 +
* [[RXN-14971]]
 +
* [[RXN-15378]]
 +
* [[RXN-22]]
 +
* [[SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=thyroxine sulfate}}
+
{{#set: common-name=fumarate}}
{{#set: molecular-weight=855.924}}
+
{{#set: molecular-weight=114.057}}
{{#set: inchi-key=inchikey=qyxijuzwssqict-lbprgkrzsa-m}}
+
{{#set: inchi-key=inchikey=vzcyooqtpochfl-owojbtedsa-l}}

Revision as of 15:14, 15 March 2021

Metabolite FUM

  • common-name:
    • fumarate
  • molecular-weight:
    • 114.057
  • inchi-key:
    • vzcyooqtpochfl-owojbtedsa-l
  • smiles:
    • c(c([o-])=o)=cc(=o)[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality