Difference between revisions of "Curation"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite FUM == * common-name: ** fumarate * molecular-weight: ** 114.057 * inchi-key: ** vzcyooqtpochfl-owojbtedsa-l * smiles: ** c(c([o-])=o)=cc...") |
(Created page with "Category:metabolite == Metabolite CPD-14602 == * common-name: ** mycophenolic acid o-acyl-glucuronide * molecular-weight: ** 495.459 * inchi-key: ** qbmstezxamabff-uearnrk...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-14602 == |
* common-name: | * common-name: | ||
| − | ** | + | ** mycophenolic acid o-acyl-glucuronide |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 495.459 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** qbmstezxamabff-uearnrkisa-m |
* smiles: | * smiles: | ||
| − | ** c(c([o-])=o)= | + | ** cc(ccc(oc1(c(o)c(c(o)c(c([o-])=o)o1)o))=o)=ccc2(=c(c(c)=c3(coc(=o)c(=c(o)2)3))oc) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-13607]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=mycophenolic acid o-acyl-glucuronide}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=495.459}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qbmstezxamabff-uearnrkisa-m}} |
Revision as of 19:04, 17 March 2021
Contents
Metabolite CPD-14602
- common-name:
- mycophenolic acid o-acyl-glucuronide
- molecular-weight:
- 495.459
- inchi-key:
- qbmstezxamabff-uearnrkisa-m
- smiles:
- cc(ccc(oc1(c(o)c(c(o)c(c([o-])=o)o1)o))=o)=ccc2(=c(c(c)=c3(coc(=o)c(=c(o)2)3))oc)
