Difference between revisions of "Curation"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11407 == * common-name: ** thyroxine sulfate * molecular-weight: ** 855.924 * inchi-key: ** qyxijuzwssqict-lbprgkrzsa-m * smiles: **...")
(Created page with "{{#ask: Category:reaction reconstruction tool::curation | ?common-name | ?ec-number | ?reconstruction category | ?reconstruction source | ?reconstruction comment | ?nb...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
{{#ask: [[Category:reaction]] [[reconstruction tool::curation]]
== Metabolite CPD-11407 ==
+
| ?common-name
* common-name:
+
| ?ec-number
** thyroxine sulfate
+
| ?reconstruction category
* molecular-weight:
+
| ?reconstruction source
** 855.924
+
| ?reconstruction comment
* inchi-key:
+
| ?nb gene associated
** qyxijuzwssqict-lbprgkrzsa-m
+
| ?nb pathway associated
* smiles:
+
}}
** c2(c(i)=c(oc1(c=c(c(os(=o)(=o)[o-])=c(c=1)i)i))c(=cc=2cc(c(=o)[o-])[n+])i)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
* [[RXN-10614]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=thyroxine sulfate}}
 
{{#set: molecular-weight=855.924}}
 
{{#set: inchi-key=inchikey=qyxijuzwssqict-lbprgkrzsa-m}}
 

Latest revision as of 19:37, 17 March 2021