Difference between revisions of "DIMETHYLARSINATE"

Revision as of 17:58, 13 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-14602 ==
+== Metabolite FUM ==
 * common-name:
-** mycophenolic acid o-acyl-glucuronide
+** fumarate
 * molecular-weight:
-** 495.459
+** 114.057
 * inchi-key:
-** qbmstezxamabff-uearnrkisa-m
+** vzcyooqtpochfl-owojbtedsa-l
 * smiles:
-** cc(ccc(oc1(c(o)c(c(o)c(c([o-])=o)o1)o))=o)=ccc2(=c(c(c)=c3(coc(=o)c(=c(o)2)3))oc)
+** c(c([o-])=o)=cc(=o)[o-]
 == Reaction(s) known to consume the compound ==
+* [[AICARSYN-RXN]]
+* [[AMPSYN-RXN]]
+* [[ARGSUCCINLYA-RXN]]
+* [[FUMARATE-REDUCTASE-NADH-RXN]]
+* [[FUMHYDR-RXN]]
+* [[RXN0-5245]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-13607]]
+* [[AICARSYN-RXN]]
+* [[AMPSYN-RXN]]
+* [[ARGSUCCINLYA-RXN]]
+* [[FUMARATE-REDUCTASE-NADH-RXN]]
+* [[FUMHYDR-RXN]]
+* [[RXN-14971]]
+* [[RXN-15378]]
+* [[RXN-22]]
+* [[SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=mycophenolic acid o-acyl-glucuronide}}
+{{#set: common-name=fumarate}}
-{{#set: molecular-weight=495.459}}
+{{#set: molecular-weight=114.057}}
-{{#set: inchi-key=inchikey=qbmstezxamabff-uearnrkisa-m}}
+{{#set: inchi-key=inchikey=vzcyooqtpochfl-owojbtedsa-l}}