Difference between revisions of "DNA-Holder"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12017 == * common-name: ** n-acetyl-serotonin sulfate * molecular-weight: ** 297.305 * inchi-key: ** ucajznvfrvluls-uhfffaoysa-m * sm...")
(Created page with "Category:metabolite == Metabolite DNA-Holder == * common-name: ** dna == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound == * 3...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12017 ==
+
== Metabolite DNA-Holder ==
 
* common-name:
 
* common-name:
** n-acetyl-serotonin sulfate
+
** dna
* molecular-weight:
 
** 297.305
 
* inchi-key:
 
** ucajznvfrvluls-uhfffaoysa-m
 
* smiles:
 
** cc(=o)nccc1(=cnc2(=cc=c(os([o-])(=o)=o)c=c12))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11059]]
+
* [[3.1.26.4-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-acetyl-serotonin sulfate}}
+
{{#set: common-name=dna}}
{{#set: molecular-weight=297.305}}
 
{{#set: inchi-key=inchikey=ucajznvfrvluls-uhfffaoysa-m}}
 

Latest revision as of 19:34, 17 March 2021

Metabolite DNA-Holder

  • common-name:
    • dna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality