Difference between revisions of "Diamines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PRPP == * common-name: ** 5-phospho-α-d-ribose 1-diphosphate * molecular-weight: ** 385.031 * inchi-key: ** pqgcedqwhsbajp-txicztdv...")
 
(Created page with "Category:metabolite == Metabolite Diamines == * common-name: ** a diamine == Reaction(s) known to consume the compound == * RXN-9599 == Reaction(s) known to produce th...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PRPP ==
+
== Metabolite Diamines ==
 
* common-name:
 
* common-name:
** 5-phospho-α-d-ribose 1-diphosphate
+
** a diamine
* molecular-weight:
 
** 385.031
 
* inchi-key:
 
** pqgcedqwhsbajp-txicztdvsa-i
 
* smiles:
 
** c(op(=o)([o-])[o-])c1(oc(op([o-])(=o)op([o-])(=o)[o-])c(o)c(o)1)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ADENPRIBOSYLTRAN-RXN]]
+
* [[RXN-9599]]
* [[ATPPHOSPHORIBOSYLTRANS-RXN]]
 
* [[NICOTINATEPRIBOSYLTRANS-RXN]]
 
* [[OROPRIBTRANS-RXN]]
 
* [[PRPPAMIDOTRANS-RXN]]
 
* [[PRPPSYN-RXN]]
 
* [[PRTRANS-RXN]]
 
* [[QUINOPRIBOTRANS-RXN]]
 
* [[RXN-14270]]
 
* [[URACIL-PRIBOSYLTRANS-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ATPPHOSPHORIBOSYLTRANS-RXN]]
 
* [[OROPRIBTRANS-RXN]]
 
* [[PRPPAMIDOTRANS-RXN]]
 
* [[PRPPSYN-RXN]]
 
* [[PRTRANS-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-phospho-α-d-ribose 1-diphosphate}}
+
{{#set: common-name=a diamine}}
{{#set: molecular-weight=385.031}}
 
{{#set: inchi-key=inchikey=pqgcedqwhsbajp-txicztdvsa-i}}
 

Latest revision as of 19:35, 17 March 2021

Metabolite Diamines

  • common-name:
    • a diamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality