Difference between revisions of "Dicarboxylate"
Jump to navigation
Jump to search
(Created page with "{{#ask: Category:pathway | ?common-name | ?nb reaction found | ?nb total reaction | ?completion rate |sort=completion rate, nb total reaction |order=descending }}") |
(Created page with "Category:metabolite == Metabolite D-MYO-INOSITOL-4-PHOSPHATE == * common-name: ** 1d-myo-inositol 4-monophosphate * molecular-weight: ** 258.121 * inchi-key: ** inapmgsxuv...") |
||
Line 1: | Line 1: | ||
− | + | [[Category:metabolite]] | |
− | + | == Metabolite D-MYO-INOSITOL-4-PHOSPHATE == | |
− | + | * common-name: | |
− | + | ** 1d-myo-inositol 4-monophosphate | |
− | + | * molecular-weight: | |
− | + | ** 258.121 | |
− | + | * inchi-key: | |
− | }} | + | ** inapmgsxuvuwaf-cnwjwelysa-l |
+ | * smiles: | ||
+ | ** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1) | ||
+ | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-10952]] | ||
+ | == Reaction(s) known to produce the compound == | ||
+ | * [[3.1.3.57-RXN]] | ||
+ | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=1d-myo-inositol 4-monophosphate}} | ||
+ | {{#set: molecular-weight=258.121}} | ||
+ | {{#set: inchi-key=inchikey=inapmgsxuvuwaf-cnwjwelysa-l}} |
Revision as of 15:14, 15 March 2021
Contents
Metabolite D-MYO-INOSITOL-4-PHOSPHATE
- common-name:
- 1d-myo-inositol 4-monophosphate
- molecular-weight:
- 258.121
- inchi-key:
- inapmgsxuvuwaf-cnwjwelysa-l
- smiles:
- c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1)