Difference between revisions of "Dicarboxylate"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19169 == * common-name: ** 3-oxo-(9z)-octadecenoyl-coa * molecular-weight: ** 1041.936 * inchi-key: ** aveyykdekgjvbu-bpmmelmssa-j *...")
 
(Created page with "Category:metabolite == Metabolite dicarboxylate == * common-name: ** a dicarboxylate == Reaction(s) known to consume the compound == * OMEGA-AMIDASE-RXN == Reaction(s)...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19169 ==
+
== Metabolite dicarboxylate ==
 
* common-name:
 
* common-name:
** 3-oxo-(9z)-octadecenoyl-coa
+
** a dicarboxylate
* molecular-weight:
 
** 1041.936
 
* inchi-key:
 
** aveyykdekgjvbu-bpmmelmssa-j
 
* smiles:
 
** ccccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17778]]
+
* [[OMEGA-AMIDASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17777]]
+
* [[OMEGA-AMIDASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-(9z)-octadecenoyl-coa}}
+
{{#set: common-name=a dicarboxylate}}
{{#set: molecular-weight=1041.936}}
 
{{#set: inchi-key=inchikey=aveyykdekgjvbu-bpmmelmssa-j}}
 

Latest revision as of 19:37, 17 March 2021

Metabolite dicarboxylate

  • common-name:
    • a dicarboxylate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality