Difference between revisions of "Epoxides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15676 == * common-name: ** 6-trans-3-oxo-tridecenoyl-coa * molecular-weight: ** 971.802 * inchi-key: ** fdxhxlpclxeysu-hmxwsvnbsa-j *...")
(Created page with "Category:metabolite == Metabolite epoxides == * common-name: ** an epoxide == Reaction(s) known to consume the compound == * 3.3.2.10-RXN == Reaction(s) known to produ...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15676 ==
+
== Metabolite epoxides ==
 
* common-name:
 
* common-name:
** 6-trans-3-oxo-tridecenoyl-coa
+
** an epoxide
* molecular-weight:
 
** 971.802
 
* inchi-key:
 
** fdxhxlpclxeysu-hmxwsvnbsa-j
 
* smiles:
 
** ccccccc=cccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14788]]
+
* [[3.3.2.10-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6-trans-3-oxo-tridecenoyl-coa}}
+
{{#set: common-name=an epoxide}}
{{#set: molecular-weight=971.802}}
 
{{#set: inchi-key=inchikey=fdxhxlpclxeysu-hmxwsvnbsa-j}}
 

Latest revision as of 19:32, 17 March 2021

Metabolite epoxides

  • common-name:
    • an epoxide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality