Difference between revisions of "FRU1P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Tripeptidyl-Peptidase-I-Substrates == * common-name: ** a tripeptidyl-peptidase i substrate == Reaction(s) known to consume the compound...") |
(Created page with "Category:metabolite == Metabolite URIDINE == * common-name: ** uridine * molecular-weight: ** 244.204 * inchi-key: ** drtqhjpvmgbucf-xvfcmesisa-n * smiles: ** c(o)c1(oc(c(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite URIDINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** uridine |
| + | * molecular-weight: | ||
| + | ** 244.204 | ||
| + | * inchi-key: | ||
| + | ** drtqhjpvmgbucf-xvfcmesisa-n | ||
| + | * smiles: | ||
| + | ** c(o)c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[URIDINEKIN-RXN]] |
| + | * [[URKI-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[CYTIDEAM2-RXN]] | ||
| + | * [[RXN-14025]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=uridine}} |
| + | {{#set: molecular-weight=244.204}} | ||
| + | {{#set: inchi-key=inchikey=drtqhjpvmgbucf-xvfcmesisa-n}} | ||
Revision as of 17:54, 13 January 2021
Contents
Metabolite URIDINE
- common-name:
- uridine
- molecular-weight:
- 244.204
- inchi-key:
- drtqhjpvmgbucf-xvfcmesisa-n
- smiles:
- c(o)c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
