Difference between revisions of "FRU1P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite URIDINE == * common-name: ** uridine * molecular-weight: ** 244.204 * inchi-key: ** drtqhjpvmgbucf-xvfcmesisa-n * smiles: ** c(o)c1(oc(c(...") |
(Created page with "Category:metabolite == Metabolite CPD-13914 == * common-name: ** cyclic-2,3-o-oxalyl-l-threonate * molecular-weight: ** 189.101 * inchi-key: ** nkbsfrftbuhmjf-uhfffaoysa-m...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-13914 == |
* common-name: | * common-name: | ||
| − | ** | + | ** cyclic-2,3-o-oxalyl-l-threonate |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 189.101 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** nkbsfrftbuhmjf-uhfffaoysa-m |
* smiles: | * smiles: | ||
| − | ** c(o)c1(oc( | + | ** c(o)c1(oc(=o)c(=o)oc(c(=o)[o-])1) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-12872]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-12869]] | |
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=cyclic-2,3-o-oxalyl-l-threonate}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=189.101}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=nkbsfrftbuhmjf-uhfffaoysa-m}} |
Revision as of 15:10, 15 March 2021
Contents
Metabolite CPD-13914
- common-name:
- cyclic-2,3-o-oxalyl-l-threonate
- molecular-weight:
- 189.101
- inchi-key:
- nkbsfrftbuhmjf-uhfffaoysa-m
- smiles:
- c(o)c1(oc(=o)c(=o)oc(c(=o)[o-])1)
