Difference between revisions of "Glycols"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-497 == * common-name: ** pseudouridine * molecular-weight: ** 244.204 * inchi-key: ** ptjwiqphwpfnbw-gbndhiklsa-n * smiles: ** c1(nc(...")
(Created page with "Category:metabolite == Metabolite FLAVANONES == * common-name: ** a flavanone == Reaction(s) known to consume the compound == * CHALCONE-ISOMERASE-RXN == Reaction(s) k...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-497 ==
+
== Metabolite FLAVANONES ==
 
* common-name:
 
* common-name:
** pseudouridine
+
** a flavanone
* molecular-weight:
 
** 244.204
 
* inchi-key:
 
** ptjwiqphwpfnbw-gbndhiklsa-n
 
* smiles:
 
** c1(nc(=o)nc(=o)c=1c2(oc(co)c(o)c(o)2))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PSEUDOURIDINE-KINASE-RXN]]
+
* [[CHALCONE-ISOMERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[CHALCONE-ISOMERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pseudouridine}}
+
{{#set: common-name=a flavanone}}
{{#set: molecular-weight=244.204}}
 
{{#set: inchi-key=inchikey=ptjwiqphwpfnbw-gbndhiklsa-n}}
 

Revision as of 15:11, 15 March 2021

Metabolite FLAVANONES

  • common-name:
    • a flavanone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality