Difference between revisions of "Hex-2-enoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite LEUKOTRIENE-C4 == * common-name: ** leukotriene-c4 * molecular-weight: ** 623.76 * inchi-key: ** gwnvdxqdilpjig-nxolixfesa-l * smiles: **...")
 
(Created page with "Category:metabolite == Metabolite Hex-2-enoyl-ACPs == * common-name: ** a (2e)-hex-2-enoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9521 * RXN-965...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite LEUKOTRIENE-C4 ==
+
== Metabolite Hex-2-enoyl-ACPs ==
 
* common-name:
 
* common-name:
** leukotriene-c4
+
** a (2e)-hex-2-enoyl-[acp]
* molecular-weight:
 
** 623.76
 
* inchi-key:
 
** gwnvdxqdilpjig-nxolixfesa-l
 
* smiles:
 
** cccccc=ccc=cc=cc=cc(scc(c(=o)ncc([o-])=o)nc(ccc(c(=o)[o-])[n+])=o)c(cccc([o-])=o)o
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-336]]
+
* [[RXN-9521]]
 +
* [[RXN-9658]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-9520]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=leukotriene-c4}}
+
{{#set: common-name=a (2e)-hex-2-enoyl-[acp]}}
{{#set: molecular-weight=623.76}}
 
{{#set: inchi-key=inchikey=gwnvdxqdilpjig-nxolixfesa-l}}
 

Latest revision as of 19:37, 17 March 2021

Metabolite Hex-2-enoyl-ACPs

  • common-name:
    • a (2e)-hex-2-enoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a (2e)-hex-2-enoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.