Difference between revisions of "I-antigens"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite FERULOYL-COA == * common-name: ** trans-feruloyl-coa * molecular-weight: ** 939.674 * inchi-key: ** gbxzvjqqdajgso-nbxnmegssa-j * smiles:...")
(Created page with "Category:metabolite == Metabolite i-Antigens == * common-name: ** an i antigen == Reaction(s) known to consume the compound == * RXN-15277 == Reaction(s) known to prod...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite FERULOYL-COA ==
+
== Metabolite i-Antigens ==
 
* common-name:
 
* common-name:
** trans-feruloyl-coa
+
** an i antigen
* molecular-weight:
 
** 939.674
 
* inchi-key:
 
** gbxzvjqqdajgso-nbxnmegssa-j
 
* smiles:
 
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=c(oc)c(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-1106]]
+
* [[RXN-15277]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[6.2.1.34-RXN]]
+
* [[RXN-15276]]
* [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=trans-feruloyl-coa}}
+
{{#set: common-name=an i antigen}}
{{#set: molecular-weight=939.674}}
 
{{#set: inchi-key=inchikey=gbxzvjqqdajgso-nbxnmegssa-j}}
 

Revision as of 15:07, 15 March 2021

Metabolite i-Antigens

  • common-name:
    • an i antigen

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality