Difference between revisions of "L-arabinofuranose"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-KETOLACTOSE == * common-name: ** 3'-ketolactose * molecular-weight: ** 340.283 * inchi-key: ** hkkhtabthsudbp-gihchdtpsa-n * smiles: **...")
(Created page with "Category:metabolite == Metabolite CPD-6321 == * common-name: ** a [procollagen] trans 4-hyroxy-l-proline == Reaction(s) known to consume the compound == == Reaction(s) kno...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-KETOLACTOSE ==
+
== Metabolite CPD-6321 ==
 
* common-name:
 
* common-name:
** 3'-ketolactose
+
** a [procollagen] trans 4-hyroxy-l-proline
* molecular-weight:
 
** 340.283
 
* inchi-key:
 
** hkkhtabthsudbp-gihchdtpsa-n
 
* smiles:
 
** c(o)c2(oc(oc1(c(co)oc(o)c(o)c(o)1))c(o)c(=o)c(o)2)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[KETOLACTOSE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[1.14.11.2-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3'-ketolactose}}
+
{{#set: common-name=a [procollagen] trans 4-hyroxy-l-proline}}
{{#set: molecular-weight=340.283}}
 
{{#set: inchi-key=inchikey=hkkhtabthsudbp-gihchdtpsa-n}}
 

Revision as of 19:00, 17 March 2021

Metabolite CPD-6321

  • common-name:
    • a [procollagen] trans 4-hyroxy-l-proline

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [procollagen] trans 4-hyroxy-l-proline" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.