Difference between revisions of "L-arabinofuranose"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite LIOTHYRONINE == * common-name: ** 3,5,3'-triiodo-l-thyronine * molecular-weight: ** 650.978 * inchi-key: ** auyycjsjgjycds-lbprgkrzsa-n *...")
(Created page with "Category:metabolite == Metabolite L-arabinofuranose == == Reaction(s) known to consume the compound == * RXN-14809 == Reaction(s) known to produce the compound == * ...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite LIOTHYRONINE ==
+
== Metabolite L-arabinofuranose ==
* common-name:
 
** 3,5,3'-triiodo-l-thyronine
 
* molecular-weight:
 
** 650.978
 
* inchi-key:
 
** auyycjsjgjycds-lbprgkrzsa-n
 
* smiles:
 
** c1(c=c(o)c(i)=cc=1oc2(=c(i)c=c(c=c(i)2)cc([n+])c(=o)[o-]))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10607]]
+
* [[RXN-14809]]
* [[RXN-10609]]
 
* [[RXN-10615]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-14809]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3,5,3'-triiodo-l-thyronine}}
 
{{#set: molecular-weight=650.978}}
 
{{#set: inchi-key=inchikey=auyycjsjgjycds-lbprgkrzsa-n}}
 

Latest revision as of 19:34, 17 March 2021

Metabolite L-arabinofuranose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality