Difference between revisions of "LYS-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17464 == * common-name: ** (9z)-tetradecenoyl-coa * molecular-weight: ** 971.845 * inchi-key: ** giifecktwkzxgu-fjxlylfvsa-j * smiles...")
 
(Created page with "Category:metabolite == Metabolite CPD-13793 == * common-name: ** 3-oxo-24-ethyl-cholest-5-ene * molecular-weight: ** 412.698 * inchi-key: ** kyofijxmvnqyfc-xjzkhkohsa-n *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17464 ==
+
== Metabolite CPD-13793 ==
 
* common-name:
 
* common-name:
** (9z)-tetradecenoyl-coa
+
** 3-oxo-24-ethyl-cholest-5-ene
 
* molecular-weight:
 
* molecular-weight:
** 971.845
+
** 412.698
 
* inchi-key:
 
* inchi-key:
** giifecktwkzxgu-fjxlylfvsa-j
+
** kyofijxmvnqyfc-xjzkhkohsa-n
 
* smiles:
 
* smiles:
** ccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** ccc(c(c)c)ccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(=o)ccc(c)1[ch]2ccc(c)34))))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-12789]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16561]]
+
* [[RXN-12789]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(9z)-tetradecenoyl-coa}}
+
{{#set: common-name=3-oxo-24-ethyl-cholest-5-ene}}
{{#set: molecular-weight=971.845}}
+
{{#set: molecular-weight=412.698}}
{{#set: inchi-key=inchikey=giifecktwkzxgu-fjxlylfvsa-j}}
+
{{#set: inchi-key=inchikey=kyofijxmvnqyfc-xjzkhkohsa-n}}

Revision as of 17:57, 13 January 2021

Metabolite CPD-13793

  • common-name:
    • 3-oxo-24-ethyl-cholest-5-ene
  • molecular-weight:
    • 412.698
  • inchi-key:
    • kyofijxmvnqyfc-xjzkhkohsa-n
  • smiles:
    • ccc(c(c)c)ccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(=o)ccc(c)1[ch]2ccc(c)34))))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality