Difference between revisions of "MANNOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-130 == * common-name: ** zeaxanthin * molecular-weight: ** 568.881 * inchi-key: ** jkqxzkusfckogq-qaybqhtqsa-n * smiles: ** cc(c=cc...")
 
(Created page with "Category:metabolite == Metabolite MANNOSE == * common-name: ** d-mannose == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound == *...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD1F-130 ==
+
== Metabolite MANNOSE ==
 
* common-name:
 
* common-name:
** zeaxanthin
+
** d-mannose
* molecular-weight:
 
** 568.881
 
* inchi-key:
 
** jkqxzkusfckogq-qaybqhtqsa-n
 
* smiles:
 
** cc(c=cc=c(c=cc1(c(c)(c)cc(cc=1c)o))c)=cc=cc=c(c=cc=c(c=cc2(=c(cc(cc(c)(c)2)o)c))c)c
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13185]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13185]]
+
* [[3.2.1.113-RXN]]
* [[RXN-7985]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=zeaxanthin}}
+
{{#set: common-name=d-mannose}}
{{#set: molecular-weight=568.881}}
 
{{#set: inchi-key=inchikey=jkqxzkusfckogq-qaybqhtqsa-n}}
 

Latest revision as of 19:34, 17 March 2021

Metabolite MANNOSE

  • common-name:
    • d-mannose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality