Difference between revisions of "MRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE == * common-name: ** 5-amino-1-(5-phospho-β-d-ribosyl)imidazole * molecular-weight: ** 294.18 * in...")
 
(Created page with "Category:metabolite == Metabolite mRNAs == * common-name: ** an mrna == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound == * 3....")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE ==
+
== Metabolite mRNAs ==
 
* common-name:
 
* common-name:
** 5-amino-1-(5-phospho-β-d-ribosyl)imidazole
+
** an mrna
* molecular-weight:
 
** 294.18
 
* inchi-key:
 
** pdacukokvhbvhj-xvfcmesisa-m
 
* smiles:
 
** c2([n+]=cn(c1(oc(cop([o-])(=o)[o-])c(o)c(o)1))c(n)=2)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[AIRCARBOXY-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[AIRCARBOXY-RXN]]
+
* [[3.1.13.4-RXN]]
* [[AIRS-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-amino-1-(5-phospho-β-d-ribosyl)imidazole}}
+
{{#set: common-name=an mrna}}
{{#set: molecular-weight=294.18}}
 
{{#set: inchi-key=inchikey=pdacukokvhbvhj-xvfcmesisa-m}}
 

Latest revision as of 19:33, 17 March 2021

Metabolite mRNAs

  • common-name:
    • an mrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality