Difference between revisions of "Microtubules"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11876 == * common-name: ** 3-methoxy-4-hydroxyphenylglycolaldehyde * molecular-weight: ** 182.176 * inchi-key: ** visajvapypfkcl-qmmm...")
(Created page with "Category:metabolite == Metabolite Microtubules == * common-name: ** a microtubule == Reaction(s) known to consume the compound == * 3.6.4.3-RXN == Reaction(s) known to...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11876 ==
+
== Metabolite Microtubules ==
 
* common-name:
 
* common-name:
** 3-methoxy-4-hydroxyphenylglycolaldehyde
+
** a microtubule
* molecular-weight:
 
** 182.176
 
* inchi-key:
 
** visajvapypfkcl-qmmmgpobsa-n
 
* smiles:
 
** coc1(=c(o)c=cc(c(o)c=o)=c1)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10917]]
+
* [[3.6.4.3-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-methoxy-4-hydroxyphenylglycolaldehyde}}
+
{{#set: common-name=a microtubule}}
{{#set: molecular-weight=182.176}}
 
{{#set: inchi-key=inchikey=visajvapypfkcl-qmmmgpobsa-n}}
 

Latest revision as of 19:34, 17 March 2021

Metabolite Microtubules

  • common-name:
    • a microtubule

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality