Difference between revisions of "Monoamines"

Revision as of 19:01, 17 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-15666 ==
+== Metabolite CPD-16618 ==
-* common-name:
+* common_name:
-** 2-trans,6-cis-tridecadienoyl-coa
+** l-malic semialdehyde
-* molecular-weight:
-** 955.803
-* inchi-key:
-** oosdlbaxvxkfib-gtubxknvsa-j
 * smiles:
-** ccccccc=cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+** c(c(=o)[o-])c(o)[ch]=o
+* inchi_key:
+** inchikey=qwhdxiuuxwgqme-gsvougtgsa-m
+* molecular_weight:
+** 117.081
 == Reaction(s) known to consume the compound ==
+* [[RXN-6002]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-14771]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=2-trans,6-cis-tridecadienoyl-coa}}
+{{#set: common_name=l-malic semialdehyde}}
-{{#set: molecular-weight=955.803}}
+{{#set: inchi_key=inchikey=qwhdxiuuxwgqme-gsvougtgsa-m}}
-{{#set: inchi-key=inchikey=oosdlbaxvxkfib-gtubxknvsa-j}}
+{{#set: molecular_weight=117.081    }}