Difference between revisions of "Nucleotides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CROTONYL-COA == * common-name: ** crotonyl-coa * molecular-weight: ** 831.577 * inchi-key: ** kfwwcmjsysspsk-bogfjhsmsa-j * smiles: ** cc...")
(Created page with "Category:metabolite == Metabolite Nucleotides == * common-name: ** a nucleotide == Reaction(s) known to consume the compound == * NUCLEOTIDASE-RXN == Reaction(s) known...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CROTONYL-COA ==
+
== Metabolite Nucleotides ==
 
* common-name:
 
* common-name:
** crotonyl-coa
+
** a nucleotide
* molecular-weight:
 
** 831.577
 
* inchi-key:
 
** kfwwcmjsysspsk-bogfjhsmsa-j
 
* smiles:
 
** cc=cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[BUTYRYL-COA-DEHYDROGENASE-RXN]]
+
* [[NUCLEOTIDASE-RXN]]
* [[RXN-11667]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[BUTYRYL-COA-DEHYDROGENASE-RXN]]
 
* [[RXN-11667]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=crotonyl-coa}}
+
{{#set: common-name=a nucleotide}}
{{#set: molecular-weight=831.577}}
 
{{#set: inchi-key=inchikey=kfwwcmjsysspsk-bogfjhsmsa-j}}
 

Latest revision as of 19:35, 17 March 2021

Metabolite Nucleotides

  • common-name:
    • a nucleotide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality