Difference between revisions of "Orthology"
Jump to navigation
Jump to search
(Created page with "{{#ask: Category:pathway | ?common-name | ?nb reaction found | ?nb total reaction | ?completion rate |sort=completion rate, nb total reaction |order=descending }}") |
(Created page with "Category:metabolite == Metabolite CPD-7414 == * common-name: ** ε-carotene * molecular-weight: ** 536.882 * inchi-key: ** qabfxomooywzlz-gdbzimipsa-n * smiles: **...") |
||
| Line 1: | Line 1: | ||
| − | + | [[Category:metabolite]] | |
| − | + | == Metabolite CPD-7414 == | |
| − | + | * common-name: | |
| − | + | ** ε-carotene | |
| − | + | * molecular-weight: | |
| − | + | ** 536.882 | |
| − | + | * inchi-key: | |
| − | }} | + | ** qabfxomooywzlz-gdbzimipsa-n |
| + | * smiles: | ||
| + | ** cc(=cc=cc=c(c)c=cc=c(c)c=cc1(c(c)(c)ccc=c(c)1))c=cc=c(c)c=cc2(c(c)=cccc(c)(c)2) | ||
| + | == Reaction(s) known to consume the compound == | ||
| + | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-8028]] | ||
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=ε-carotene}} | ||
| + | {{#set: molecular-weight=536.882}} | ||
| + | {{#set: inchi-key=inchikey=qabfxomooywzlz-gdbzimipsa-n}} | ||
Revision as of 17:58, 13 January 2021
Contents
Metabolite CPD-7414
- common-name:
- ε-carotene
- molecular-weight:
- 536.882
- inchi-key:
- qabfxomooywzlz-gdbzimipsa-n
- smiles:
- cc(=cc=cc=c(c)c=cc=c(c)c=cc1(c(c)(c)ccc=c(c)1))c=cc=c(c)c=cc2(c(c)=cccc(c)(c)2)
