Difference between revisions of "Orthology"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7414 == * common-name: ** ε-carotene * molecular-weight: ** 536.882 * inchi-key: ** qabfxomooywzlz-gdbzimipsa-n * smiles: **...")
(Created page with "{{#ask: Category:reaction reconstruction category::orthology | ?common-name | ?ec-number | ?reconstruction tool | ?reconstruction source | ?reconstruction comment | ?n...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
{{#ask: [[Category:reaction]] [[reconstruction category::orthology]]
−
== Metabolite CPD-7414 ==
+
| ?common-name
−
* common-name:
+
| ?ec-number
−
** ε-carotene
+
| ?reconstruction tool
−
* molecular-weight:
+
| ?reconstruction source
−
** 536.882
+
| ?reconstruction comment
−
* inchi-key:
+
| ?nb gene associated
−
** qabfxomooywzlz-gdbzimipsa-n
+
| ?nb pathway associated
−
* smiles:
+
}}
−
** cc(=cc=cc=c(c)c=cc=c(c)c=cc1(c(c)(c)ccc=c(c)1))c=cc=c(c)c=cc2(c(c)=cccc(c)(c)2)
 
−
== Reaction(s) known to consume the compound ==
 
−
== Reaction(s) known to produce the compound ==
 
−
* [[RXN-8028]]
 
−
== Reaction(s) of unknown directionality ==
 
−
{{#set: common-name=ε-carotene}}
 
−
{{#set: molecular-weight=536.882}}
 
−
{{#set: inchi-key=inchikey=qabfxomooywzlz-gdbzimipsa-n}}
 

Latest revision as of 19:37, 17 March 2021

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=Orthology&oldid=50440"