Difference between revisions of "Orthology"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PANTETHEINE-P == * common-name: ** 4'-phosphopantetheine * molecular-weight: ** 356.33 * inchi-key: ** jdmuprlruumctl-vifpvbqesa-l * smil...")
(Created page with "{{#ask: Category:reaction reconstruction category::orthology | ?common-name | ?ec-number | ?reconstruction tool | ?reconstruction source | ?reconstruction comment | ?n...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
{{#ask: [[Category:reaction]] [[reconstruction category::orthology]]
−
== Metabolite PANTETHEINE-P ==
+
| ?common-name
−
* common-name:
+
| ?ec-number
−
** 4'-phosphopantetheine
+
| ?reconstruction tool
−
* molecular-weight:
+
| ?reconstruction source
−
** 356.33
+
| ?reconstruction comment
−
* inchi-key:
+
| ?nb gene associated
−
** jdmuprlruumctl-vifpvbqesa-l
+
| ?nb pathway associated
−
* smiles:
+
}}
−
** cc(c(o)c(=o)nccc(nccs)=o)(c)cop([o-])(=o)[o-]
 
−
== Reaction(s) known to consume the compound ==
 
−
* [[PANTEPADENYLYLTRAN-RXN]]
 
−
== Reaction(s) known to produce the compound ==
 
−
* [[3.1.4.14-RXN]]
 
−
* [[P-PANTOCYSDECARB-RXN]]
 
−
== Reaction(s) of unknown directionality ==
 
−
{{#set: common-name=4'-phosphopantetheine}}
 
−
{{#set: molecular-weight=356.33}}
 
−
{{#set: inchi-key=inchikey=jdmuprlruumctl-vifpvbqesa-l}}
 

Latest revision as of 19:37, 17 March 2021

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=Orthology&oldid=50440"