Difference between revisions of "P-COUMAROYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite G5-pppR-mRNAs == * common-name: ** a 5'-(5'-triphosphoguanosine)-purine-[mrna] == Reaction(s) known to consume the compound == == Reactio...") |
(Created page with "Category:metabolite == Metabolite P-COUMAROYL-COA == * common-name: ** (e)-4-coumaroyl-coa * molecular-weight: ** 909.648 * inchi-key: ** dmzokbalnzwdki-matmfaihsa-j * smi...") |
||
| (2 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite P-COUMAROYL-COA == |
* common-name: | * common-name: | ||
| − | ** | + | ** (e)-4-coumaroyl-coa |
| + | * molecular-weight: | ||
| + | ** 909.648 | ||
| + | * inchi-key: | ||
| + | ** dmzokbalnzwdki-matmfaihsa-j | ||
| + | * smiles: | ||
| + | ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[NARINGENIN-CHALCONE-SYNTHASE-RXN]] | ||
| + | * [[RXN-1101]] | ||
| + | * [[RXN-11244]] | ||
| + | * [[RXN-3142]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[4-COUMARATE--COA-LIGASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(e)-4-coumaroyl-coa}} |
| + | {{#set: molecular-weight=909.648}} | ||
| + | {{#set: inchi-key=inchikey=dmzokbalnzwdki-matmfaihsa-j}} | ||
Latest revision as of 19:32, 17 March 2021
Contents
Metabolite P-COUMAROYL-COA
- common-name:
- (e)-4-coumaroyl-coa
- molecular-weight:
- 909.648
- inchi-key:
- dmzokbalnzwdki-matmfaihsa-j
- smiles:
- cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
