Difference between revisions of "P-COUMAROYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite NITRATE == * common-name: ** nitrate * molecular-weight: ** 62.005 * inchi-key: ** nhnbfggvmkefgy-uhfffaoysa-n * smiles: ** n(=o)(=o)[o-]...")
(Created page with "Category:metabolite == Metabolite P-COUMAROYL-COA == * common-name: ** (e)-4-coumaroyl-coa * molecular-weight: ** 909.648 * inchi-key: ** dmzokbalnzwdki-matmfaihsa-j * smi...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite NITRATE ==
+
== Metabolite P-COUMAROYL-COA ==
 
* common-name:
 
* common-name:
** nitrate
+
** (e)-4-coumaroyl-coa
 
* molecular-weight:
 
* molecular-weight:
** 62.005
+
** 909.648
 
* inchi-key:
 
* inchi-key:
** nhnbfggvmkefgy-uhfffaoysa-n
+
** dmzokbalnzwdki-matmfaihsa-j
 
* smiles:
 
* smiles:
** n(=o)(=o)[o-]
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ExchangeSeed-NITRATE]]
+
* [[NARINGENIN-CHALCONE-SYNTHASE-RXN]]
* [[NITRATE-REDUCTASE-NADH-RXN]]
+
* [[RXN-1101]]
* [[NITRATE-REDUCTASE-NADPH-RXN]]
+
* [[RXN-11244]]
* [[NITRATE-REDUCTASE-NADPORNOPH-RXN]]
+
* [[RXN-3142]]
* [[TCV3]]
 
* [[TransportSeed-NITRATE]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ExchangeSeed-NITRATE]]
+
* [[4-COUMARATE--COA-LIGASE-RXN]]
* [[R621-RXN]]
 
* [[TCV3]]
 
* [[TransportSeed-NITRATE]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=nitrate}}
+
{{#set: common-name=(e)-4-coumaroyl-coa}}
{{#set: molecular-weight=62.005}}
+
{{#set: molecular-weight=909.648}}
{{#set: inchi-key=inchikey=nhnbfggvmkefgy-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=dmzokbalnzwdki-matmfaihsa-j}}

Latest revision as of 19:32, 17 March 2021

Metabolite P-COUMAROYL-COA

  • common-name:
    • (e)-4-coumaroyl-coa
  • molecular-weight:
    • 909.648
  • inchi-key:
    • dmzokbalnzwdki-matmfaihsa-j
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality