Difference between revisions of "Poly-beta-D-Mannuronate"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-HEXAPRENYL-4-HYDROXYBENZOATE == * common-name: ** 3-hexaprenyl-4-hydroxybenzoate * molecular-weight: ** 545.824 * inchi-key: ** lkmqqqa...")
 
(Created page with "Category:metabolite == Metabolite CPD-12850 == * common_name: ** 4α,14α-dimethyl-9β,19-cyclo-5α-cholest-24-en-3β-ol * smiles: ** cc(c)=cccc(c)[...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-HEXAPRENYL-4-HYDROXYBENZOATE ==
+
== Metabolite CPD-12850 ==
* common-name:
+
* common_name:
** 3-hexaprenyl-4-hydroxybenzoate
+
** 4α,14α-dimethyl-9β,19-cyclo-5α-cholest-24-en-3β-ol
* molecular-weight:
 
** 545.824
 
* inchi-key:
 
** lkmqqqabigihgl-laaqxviisa-m
 
 
* smiles:
 
* smiles:
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(o)c=cc(c(=o)[o-])=c1))c)c)c)c)c
+
** cc(c)=cccc(c)[ch]3(ccc4(c)([ch]1(cc[ch]5(c(c)c(o)ccc2(cc12ccc(c)34)5))))
 +
* inchi_key:
 +
** inchikey=xzeuytksaynypk-yetbrxcgsa-n
 +
* molecular_weight:
 +
** 412.698   
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN11876]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9003]]
+
* [[RXN-21831]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-hexaprenyl-4-hydroxybenzoate}}
+
{{#set: common_name=4α,14α-dimethyl-9β,19-cyclo-5α-cholest-24-en-3β-ol}}
{{#set: molecular-weight=545.824}}
+
{{#set: inchi_key=inchikey=xzeuytksaynypk-yetbrxcgsa-n}}
{{#set: inchi-key=inchikey=lkmqqqabigihgl-laaqxviisa-m}}
+
{{#set: molecular_weight=412.698    }}

Revision as of 17:52, 13 January 2021

Metabolite CPD-12850

  • common_name:
    • 4α,14α-dimethyl-9β,19-cyclo-5α-cholest-24-en-3β-ol
  • smiles:
    • cc(c)=cccc(c)[ch]3(ccc4(c)([ch]1(cc[ch]5(c(c)c(o)ccc2(cc12ccc(c)34)5))))
  • inchi_key:
    • inchikey=xzeuytksaynypk-yetbrxcgsa-n
  • molecular_weight:
    • 412.698

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality