Difference between revisions of "RX"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DCMP == * common-name: ** dcmp * molecular-weight: ** 305.183 * inchi-key: ** ncmvoabpesmrcp-shyzeuofsa-l * smiles: ** c(c2(c(cc(n1(c(n=c...")
(Created page with "Category:metabolite == Metabolite RX == * common-name: ** rx * smiles: ** [r][x] == Reaction(s) known to consume the compound == * GSHTRAN-RXN == Reaction(s) known to...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DCMP ==
+
== Metabolite RX ==
 
* common-name:
 
* common-name:
** dcmp
+
** rx
* molecular-weight:
 
** 305.183
 
* inchi-key:
 
** ncmvoabpesmrcp-shyzeuofsa-l
 
 
* smiles:
 
* smiles:
** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op([o-])([o-])=o
+
** [r][x]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DCMP-DEAMINASE-RXN]]
+
* [[GSHTRAN-RXN]]
* [[RXN-7913]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DCTP-PYROPHOSPHATASE-RXN]]
 
* [[RXN-14187]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dcmp}}
+
{{#set: common-name=rx}}
{{#set: molecular-weight=305.183}}
 
{{#set: inchi-key=inchikey=ncmvoabpesmrcp-shyzeuofsa-l}}
 

Latest revision as of 19:35, 17 March 2021

Metabolite RX

  • common-name:
    • rx
  • smiles:
    • [r][x]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality