Difference between revisions of "RXN-15261"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite AMINO-OH-HYDROXYMETHYL-DIHYDROPTERIDINE == * common-name: ** 6-(hydroxymethyl)-7,8-dihydropterin * molecular-weight: ** 195.18 * inchi-ke...")
 
(Created page with "{{#ask: Category:reaction reconstruction category::manual | ?common-name | ?ec-number | ?reconstruction tool | ?reconstruction source | ?reconstruction comment | ?nb g...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
{{#ask: [[Category:reaction]] [[reconstruction category::manual]]
−
== Metabolite AMINO-OH-HYDROXYMETHYL-DIHYDROPTERIDINE ==
+
| ?common-name
−
* common-name:
+
| ?ec-number
−
** 6-(hydroxymethyl)-7,8-dihydropterin
+
| ?reconstruction tool
−
* molecular-weight:
+
| ?reconstruction source
−
** 195.18
+
| ?reconstruction comment
−
* inchi-key:
+
| ?nb gene associated
−
** cqqnnqtxugluev-uhfffaoysa-n
+
| ?nb pathway associated
−
* smiles:
+
}}
−
** c(o)c2(=nc1(c(=o)nc(n)=nc=1nc2))
 
−
== Reaction(s) known to consume the compound ==
 
−
* [[H2NEOPTERINALDOL-RXN]]
 
−
* [[H2PTERIDINEPYROPHOSPHOKIN-RXN]]
 
−
== Reaction(s) known to produce the compound ==
 
−
* [[H2NEOPTERINALDOL-RXN]]
 
−
== Reaction(s) of unknown directionality ==
 
−
{{#set: common-name=6-(hydroxymethyl)-7,8-dihydropterin}}
 
−
{{#set: molecular-weight=195.18}}
 
−
{{#set: inchi-key=inchikey=cqqnnqtxugluev-uhfffaoysa-n}}
 

Revision as of 17:58, 13 January 2021

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=RXN-15261&oldid=18938"