Difference between revisions of "S2O3"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15687 == * common-name: ** 5-cis, 7-trans-3-oxo-tetradecadienoyl-coa * molecular-weight: ** 983.813 * inchi-key: ** njxbfcfhvuiemz-qt...")
(Created page with "Category:metabolite == Metabolite CPD-17271 == * common-name: ** 1-stearoyl-2-palmitoyl-glycerol * molecular-weight: ** 596.973 * inchi-key: ** vyqdalbeqrzdpl-dhujradrsa-n...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15687 ==
+
== Metabolite CPD-17271 ==
 
* common-name:
 
* common-name:
** 5-cis, 7-trans-3-oxo-tetradecadienoyl-coa
+
** 1-stearoyl-2-palmitoyl-glycerol
 
* molecular-weight:
 
* molecular-weight:
** 983.813
+
** 596.973
 
* inchi-key:
 
* inchi-key:
** njxbfcfhvuiemz-qtjplklfsa-j
+
** vyqdalbeqrzdpl-dhujradrsa-n
 
* smiles:
 
* smiles:
** ccccccc=cc=ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cccccccccccccccccc(occ(oc(=o)ccccccccccccccc)co)=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14799]]
+
* [[RXN-16030]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-16030]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-cis, 7-trans-3-oxo-tetradecadienoyl-coa}}
+
{{#set: common-name=1-stearoyl-2-palmitoyl-glycerol}}
{{#set: molecular-weight=983.813}}
+
{{#set: molecular-weight=596.973}}
{{#set: inchi-key=inchikey=njxbfcfhvuiemz-qtjplklfsa-j}}
+
{{#set: inchi-key=inchikey=vyqdalbeqrzdpl-dhujradrsa-n}}

Revision as of 15:08, 15 March 2021

Metabolite CPD-17271

  • common-name:
    • 1-stearoyl-2-palmitoyl-glycerol
  • molecular-weight:
    • 596.973
  • inchi-key:
    • vyqdalbeqrzdpl-dhujradrsa-n
  • smiles:
    • cccccccccccccccccc(occ(oc(=o)ccccccccccccccc)co)=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality