Difference between revisions of "Serines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15318 == * common_name: ** α-d-ribose 5-phosphate * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)o1) * inchi_key: ** inchikey=k...") |
(Created page with "Category:metabolite == Metabolite Serines == * common-name: ** serine == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound == * P...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Serines == |
| − | * | + | * common-name: |
| − | + | ** serine | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | ** | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[PSERPHOSPHA-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: | + | {{#set: common-name=serine}} |
| − | |||
| − | |||
Latest revision as of 19:33, 17 March 2021
Contents
Metabolite Serines
- common-name:
- serine
