Difference between revisions of "Sugar"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5Z-tetradec-5-enoyl-ACPs == * common-name: ** a (5z)-tetradec-5-enoyl-[acp] == Reaction(s) known to consume the compound == * RXN-16621...") |
(Created page with "Category:metabolite == Metabolite CPD1F-2 == * common-name: ** (-)-methyl jasmonate * molecular-weight: ** 224.299 * inchi-key: ** gewdntwnsazudx-wqmvxfaesa-n * smiles: **...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD1F-2 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (-)-methyl jasmonate |
| + | * molecular-weight: | ||
| + | ** 224.299 | ||
| + | * inchi-key: | ||
| + | ** gewdntwnsazudx-wqmvxfaesa-n | ||
| + | * smiles: | ||
| + | ** ccc=ccc1(c(=o)ccc1cc(oc)=o) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-10767]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(-)-methyl jasmonate}} |
| + | {{#set: molecular-weight=224.299}} | ||
| + | {{#set: inchi-key=inchikey=gewdntwnsazudx-wqmvxfaesa-n}} | ||
Revision as of 17:53, 13 January 2021
Contents
Metabolite CPD1F-2
- common-name:
- (-)-methyl jasmonate
- molecular-weight:
- 224.299
- inchi-key:
- gewdntwnsazudx-wqmvxfaesa-n
- smiles:
- ccc=ccc1(c(=o)ccc1cc(oc)=o)
