Difference between revisions of "TRANS-D2-ENOYL-ACP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-DEOXY-D-ARABINO-HEPTULOSONATE-7-P == * common-name: ** 3-deoxy-d-arabino-heptulosonate 7-phosphate * molecular-weight: ** 285.124 * inc...")
(Created page with "Category:metabolite == Metabolite TRANS-D2-ENOYL-ACP == * common-name: ** a trans-2-enoyl-[acyl-carrier protein] == Reaction(s) known to consume the compound == * 1.3.1....")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-DEOXY-D-ARABINO-HEPTULOSONATE-7-P ==
+
== Metabolite TRANS-D2-ENOYL-ACP ==
 
* common-name:
 
* common-name:
** 3-deoxy-d-arabino-heptulosonate 7-phosphate
+
** a trans-2-enoyl-[acyl-carrier protein]
* molecular-weight:
 
** 285.124
 
* inchi-key:
 
** pjwipexiffqaqz-pufimzngsa-k
 
* smiles:
 
** c(=o)([o-])c(=o)cc(o)c(o)c(o)cop([o-])(=o)[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3-DEHYDROQUINATE-SYNTHASE-RXN]]
+
* [[1.3.1.9-RXN]]
* [[DAHPSYN-RXN]]
+
* [[ENOYL-ACP-REDUCT-NADH-RXN]]
 +
* [[ENOYL-ACP-REDUCT-NADPH-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DAHPSYN-RXN]]
+
* [[1.3.1.9-RXN]]
 +
* [[3-HYDROXYDECANOYL-ACP-DEHYDR-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-deoxy-d-arabino-heptulosonate 7-phosphate}}
+
{{#set: common-name=a trans-2-enoyl-[acyl-carrier protein]}}
{{#set: molecular-weight=285.124}}
 
{{#set: inchi-key=inchikey=pjwipexiffqaqz-pufimzngsa-k}}
 

Latest revision as of 19:35, 17 March 2021

Metabolite TRANS-D2-ENOYL-ACP

  • common-name:
    • a trans-2-enoyl-[acyl-carrier protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a trans-2-enoyl-[acyl-carrier protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.